C24H23ClN6O4S — CID 134552265
1-[5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-3-pyridinyl]azetidin-2-one (PubChem CID 134552265) has the molecular formula C24H23ClN6O4S and a molecular weight of 527.01 g/mol. Its IUPAC name is 1-[5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-3-pyridinyl]azetidin-2-one.
| Compound Name | 1-[5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-3-pyridinyl]azetidin-2-one |
|---|---|
| PubChem CID | 134552265 |
| Molecular Formula | C24H23ClN6O4S |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 1-[5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]amino]sulfanylethyl]-3-pyridinyl]azetidin-2-one |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(Cl)cc2N2CCC2=O)nnc1-c1ccco1 |
| InChI | InChI=1S/C24H23ClN6O4S/c1-33-18-5-3-6-19(34-2)22(18)31-23(20-7-4-11-35-20)27-28-24(31)29-36-12-9-16-17(13-15(25)14-26-16)30-10-8-21(30)32/h3-7,11,13-14H,8-10,12H2,1-2H3,(H,28,29) |
| InChIKey | UZZKAYMAIJNOOY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|