C22H20ClN5O6S — CID 134543728
(3S)-7-chloro-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-3,4-dihydro-2H-pyrano[3,2-b]pyridine-3-sulfonamide (PubChem CID 134543728) has the molecular formula C22H20ClN5O6S and a molecular weight of 517.95 g/mol. Its IUPAC name is (3S)-7-chloro-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-3,4-dihydro-2H-pyrano[3,2-b]pyridine-3-sulfonamide.
| Compound Name | (3S)-7-chloro-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-3,4-dihydro-2H-pyrano[3,2-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 134543728 |
| Molecular Formula | C22H20ClN5O6S |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (3S)-7-chloro-N-[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]-3,4-dihydro-2H-pyrano[3,2-b]pyridine-3-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@@H]2COc3cc(Cl)cnc3C2)nnc1-c1ccco1 |
| InChI | InChI=1S/C22H20ClN5O6S/c1-31-16-5-3-6-17(32-2)20(16)28-21(18-7-4-8-33-18)25-26-22(28)27-35(29,30)14-10-15-19(34-12-14)9-13(23)11-24-15/h3-9,11,14H,10,12H2,1-2H3,(H,26,27)/t14-/m0/s1 |
| InChIKey | HOQHYVYGVNWFBX-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |