C21H19BrClN5O3S — CID 134552756
N-[2-(3-bromo-5-chloro-2-pyridinyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 134552756) has the molecular formula C21H19BrClN5O3S and a molecular weight of 536.84 g/mol. Its IUPAC name is N-[2-(3-bromo-5-chloro-2-pyridinyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | N-[2-(3-bromo-5-chloro-2-pyridinyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134552756 |
| Molecular Formula | C21H19BrClN5O3S |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | N-[2-(3-bromo-5-chloro-2-pyridinyl)ethylsulfanyl]-4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSCCc2ncc(Cl)cc2Br)nnc1-c1ccco1 |
| InChI | InChI=1S/C21H19BrClN5O3S/c1-29-16-5-3-6-17(30-2)19(16)28-20(18-7-4-9-31-18)25-26-21(28)27-32-10-8-15-14(22)11-13(23)12-24-15/h3-7,9,11-12H,8,10H2,1-2H3,(H,26,27) |
| InChIKey | MZZURIIKODZJPY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|