C27H28ClN5O5S — CID 147111612
5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]ethyl]-3-(1,2,3,6-tetrahydropyridin-4-yl)pyridine (PubChem CID 147111612) has the molecular formula C27H28ClN5O5S and a molecular weight of 570.07 g/mol. Its IUPAC name is 5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]ethyl]-3-(1,2,3,6-tetrahydropyridin-4-yl)pyridine.
| Compound Name | 5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]ethyl]-3-(1,2,3,6-tetrahydropyridin-4-yl)pyridine |
|---|---|
| PubChem CID | 147111612 |
| Molecular Formula | C27H28ClN5O5S |
| Molecular Weight | 570.07 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 5-chloro-2-[2-[[4-(2,6-dimethoxyphenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]ethyl]-3-(1,2,3,6-tetrahydropyridin-4-yl)pyridine |
| SMILES | COc1cccc(OC)c1-n1c(CS(=O)(=O)CCc2ncc(Cl)cc2C2=CCNCC2)nnc1-c1ccco1 |
| InChI | InChI=1S/C27H28ClN5O5S/c1-36-22-5-3-6-23(37-2)26(22)33-25(31-32-27(33)24-7-4-13-38-24)17-39(34,35)14-10-21-20(15-19(28)16-30-21)18-8-11-29-12-9-18/h3-8,13,15-16,29H,9-12,14,17H2,1-2H3 |
| InChIKey | BMPMYGQAAYMAPA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.07 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |