C21H21FN6O3S — CID 134552282
4-(2,6-dimethoxyphenyl)-N-[1-(5-fluoropyrimidin-2-yl)propan-2-ylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 134552282) has the molecular formula C21H21FN6O3S and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[1-(5-fluoropyrimidin-2-yl)propan-2-ylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[1-(5-fluoropyrimidin-2-yl)propan-2-ylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134552282 |
| Molecular Formula | C21H21FN6O3S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[1-(5-fluoropyrimidin-2-yl)propan-2-ylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSC(C)Cc2ncc(F)cn2)nnc1-c1ccco1 |
| InChI | InChI=1S/C21H21FN6O3S/c1-13(10-18-23-11-14(22)12-24-18)32-27-21-26-25-20(17-8-5-9-31-17)28(21)19-15(29-2)6-4-7-16(19)30-3/h4-9,11-13H,10H2,1-3H3,(H,26,27) |
| InChIKey | KWDQVTDFMZUYPY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|