C23H29N7O2S2 — CID 142359716
4-(2,6-dimethoxyphenyl)-N-[2-(5-methylpyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine;ethane (PubChem CID 142359716) has the molecular formula C23H29N7O2S2 and a molecular weight of 499.67 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[2-(5-methylpyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine;ethane.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-methylpyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine;ethane |
|---|---|
| PubChem CID | 142359716 |
| Molecular Formula | C23H29N7O2S2 |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[2-(5-methylpyrimidin-2-yl)ethylsulfanyl]-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-amine;ethane |
| SMILES | CC.COc1cccc(OC)c1-n1c(NSCCc2ncc(C)cn2)nnc1-c1nc(C)cs1 |
| InChI | InChI=1S/C21H23N7O2S2.C2H6/c1-13-10-22-17(23-11-13)8-9-32-27-21-26-25-19(20-24-14(2)12-31-20)28(21)18-15(29-3)6-5-7-16(18)30-4;1-2/h5-7,10-12H,8-9H2,1-4H3,(H,26,27);1-2H3 |
| InChIKey | ZQIOMXREOJFJCX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|