C23H26N6O5S2 — CID 161499866
(1R,2S)-2-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-methylpyrimidin-2-yl)propan-1-ol (PubChem CID 161499866) has the molecular formula C23H26N6O5S2 and a molecular weight of 530.63 g/mol. Its IUPAC name is (1R,2S)-2-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-methylpyrimidin-2-yl)propan-1-ol.
| Compound Name | (1R,2S)-2-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-methylpyrimidin-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 161499866 |
| Molecular Formula | C23H26N6O5S2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (1R,2S)-2-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-methylpyrimidin-2-yl)propan-1-ol |
| SMILES | COc1cccc(OC)c1-n1c(CS(=O)(=O)[C@@H](C)[C@H](O)c2ncc(C)cn2)nnc1-c1nc(C)cs1 |
| InChI | InChI=1S/C23H26N6O5S2/c1-13-9-24-21(25-10-13)20(30)15(3)36(31,32)12-18-27-28-22(23-26-14(2)11-35-23)29(18)19-16(33-4)7-6-8-17(19)34-5/h6-11,15,20,30H,12H2,1-5H3/t15-,20-/m0/s1 |
| InChIKey | UCWSIDALJLURAM-YWZLYKJASA-N |
| XLogP | 2.85 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |