C24H26FN7O5S2 — CID 159376099
(3R,5R)-5-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-fluoropyrimidin-2-yl)piperidin-3-ol (PubChem CID 159376099) has the molecular formula C24H26FN7O5S2 and a molecular weight of 575.65 g/mol. Its IUPAC name is (3R,5R)-5-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-fluoropyrimidin-2-yl)piperidin-3-ol.
| Compound Name | (3R,5R)-5-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-fluoropyrimidin-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 159376099 |
| Molecular Formula | C24H26FN7O5S2 |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | (3R,5R)-5-[[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]methylsulfonyl]-1-(5-fluoropyrimidin-2-yl)piperidin-3-ol |
| SMILES | COc1cccc(OC)c1-n1c(CS(=O)(=O)[C@@H]2C[C@@H](O)CN(c3ncc(F)cn3)C2)nnc1-c1nc(C)cs1 |
| InChI | InChI=1S/C24H26FN7O5S2/c1-14-12-38-23(28-14)22-30-29-20(32(22)21-18(36-2)5-4-6-19(21)37-3)13-39(34,35)17-7-16(33)10-31(11-17)24-26-8-15(25)9-27-24/h4-6,8-9,12,16-17,33H,7,10-11,13H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | DUMHWOGCSIUZRR-IAGOWNOFSA-N |
| XLogP | 2.20 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |