C21H22FN7O5S2 — CID 134542207
(1R,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-hydroxypropane-2-sulfonamide (PubChem CID 134542207) has the molecular formula C21H22FN7O5S2 and a molecular weight of 535.58 g/mol. Its IUPAC name is (1R,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-hydroxypropane-2-sulfonamide.
| Compound Name | (1R,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-hydroxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 134542207 |
| Molecular Formula | C21H22FN7O5S2 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | (1R,2R)-N-[4-(2,6-dimethoxyphenyl)-5-(4-methyl-1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]-1-(5-fluoropyrimidin-2-yl)-1-hydroxypropane-2-sulfonamide |
| SMILES | COc1cccc(OC)c1-n1c(NS(=O)(=O)[C@H](C)[C@H](O)c2ncc(F)cn2)nnc1-c1nc(C)cs1 |
| InChI | InChI=1S/C21H22FN7O5S2/c1-11-10-35-20(25-11)19-26-27-21(29(19)16-14(33-3)6-5-7-15(16)34-4)28-36(31,32)12(2)17(30)18-23-8-13(22)9-24-18/h5-10,12,17,30H,1-4H3,(H,27,28)/t12-,17+/m1/s1 |
| InChIKey | OIPZHSLJCSVMSH-PXAZEXFGSA-N |
| XLogP | 2.51 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |