C22H26N5O2S+ — CID 7150398
ethyl (3R)-1-[(4-phenyl-3-pyridin-4-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 7150398) has the molecular formula C22H26N5O2S+ and a molecular weight of 424.55 g/mol. Its IUPAC name is ethyl (3R)-1-[(4-phenyl-3-pyridin-4-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(4-phenyl-3-pyridin-4-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7150398 |
| Molecular Formula | C22H26N5O2S+ |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | ethyl (3R)-1-[(4-phenyl-3-pyridin-4-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](Cn2nc(-c3ccncc3)n(-c3ccccc3)c2=S)C1 |
| InChI | InChI=1S/C22H25N5O2S/c1-2-29-21(28)18-7-6-14-25(15-18)16-26-22(30)27(19-8-4-3-5-9-19)20(24-26)17-10-12-23-13-11-17/h3-5,8-13,18H,2,6-7,14-16H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | GFTONKNURPNQMJ-GOSISDBHSA-O |
| XLogP | 2.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|