C16H21ClN5O2S+ — CID 9242969
ethyl (3R)-1-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-3-carboxylate (PubChem CID 9242969) has the molecular formula C16H21ClN5O2S+ and a molecular weight of 382.90 g/mol. Its IUPAC name is ethyl (3R)-1-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 9242969 |
| Molecular Formula | C16H21ClN5O2S+ |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl (3R)-1-[[4-(3-chlorophenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](Cn2nnn(-c3cccc(Cl)c3)c2=S)C1 |
| InChI | InChI=1S/C16H20ClN5O2S/c1-2-24-15(23)12-5-4-8-20(10-12)11-21-16(25)22(19-18-21)14-7-3-6-13(17)9-14/h3,6-7,9,12H,2,4-5,8,10-11H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | KTVGSBUBUMYESJ-GFCCVEGCSA-O |
| XLogP | 1.27 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|