C18H26N5O2S+ — CID 9245475
ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-4-carboxylate (PubChem CID 9245475) has the molecular formula C18H26N5O2S+ and a molecular weight of 376.51 g/mol. Its IUPAC name is ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9245475 |
| Molecular Formula | C18H26N5O2S+ |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cn2nnn(-c3cccc(C)c3C)c2=S)CC1 |
| InChI | InChI=1S/C18H25N5O2S/c1-4-25-17(24)15-8-10-21(11-9-15)12-22-18(26)23(20-19-22)16-7-5-6-13(2)14(16)3/h5-7,15H,4,8-12H2,1-3H3/p+1 |
| InChIKey | GWTGRHVTXIVZMI-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|