C18H26N3O2S+ — CID 9169595
ethyl 1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 9169595) has the molecular formula C18H26N3O2S+ and a molecular weight of 348.49 g/mol. Its IUPAC name is ethyl 1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9169595 |
| Molecular Formula | C18H26N3O2S+ |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | ethyl 1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cn2c(C)c(C)c(C)c(C#N)c2=S)CC1 |
| InChI | InChI=1S/C18H25N3O2S/c1-5-23-18(22)15-6-8-20(9-7-15)11-21-14(4)12(2)13(3)16(10-19)17(21)24/h15H,5-9,11H2,1-4H3/p+1 |
| InChIKey | YTNRWUOJFBVVML-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 59.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|