C18H25N3O2S — CID 9169739
ethyl (3S)-1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidine-3-carboxylate (PubChem CID 9169739) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is ethyl (3S)-1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 9169739 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | ethyl (3S)-1-[(5-cyano-2,3,4-trimethyl-6-sulfanylidene-1-pyridinyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cn2c(C)c(C)c(C)c(C#N)c2=S)C1 |
| InChI | InChI=1S/C18H25N3O2S/c1-5-23-18(22)15-7-6-8-20(10-15)11-21-14(4)12(2)13(3)16(9-19)17(21)24/h15H,5-8,10-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | VPIORAZAYIWRNM-HNNXBMFYSA-N |
| XLogP | 3.25 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|