C16H20N2O2S2 — CID 4031806
ethyl 1-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methyl]piperidine-3-carboxylate (PubChem CID 4031806) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethyl 1-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4031806 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | ethyl 1-[(2-sulfanylidene-1,3-benzothiazol-3-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cn2c(=S)sc3ccccc32)C1 |
| InChI | InChI=1S/C16H20N2O2S2/c1-2-20-15(19)12-6-5-9-17(10-12)11-18-13-7-3-4-8-14(13)22-16(18)21/h3-4,7-8,12H,2,5-6,9-11H2,1H3 |
| InChIKey | UOAFROIWFOPEPQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|