C13H18ClNO2S — CID 81339175
ethyl (3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidine-3-carboxylate (PubChem CID 81339175) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is ethyl (3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81339175 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | ethyl (3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-2-17-13(16)10-4-3-7-15(8-10)9-11-5-6-12(14)18-11/h5-6,10H,2-4,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | RAAIVOUJZGLQCQ-JTQLQIEISA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |