C25H32N4O4S2 — CID 6316923
ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propyl-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 6316923) has the molecular formula C25H32N4O4S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propyl-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propyl-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 6316923 |
| Molecular Formula | C25H32N4O4S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | ethyl 1-[5-cyano-4-methyl-6-oxo-3-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propyl-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCCN1C(=O)/C(=C/c2c(C)c(C#N)c(=O)n(CCC)c2N2CCC(C(=O)OCC)CC2)SC1=S |
| InChI | InChI=1S/C25H32N4O4S2/c1-5-10-28-21(27-12-8-17(9-13-27)24(32)33-7-3)18(16(4)19(15-26)22(28)30)14-20-23(31)29(11-6-2)25(34)35-20/h14,17H,5-13H2,1-4H3/b20-14- |
| InChIKey | YWBRESBVWGURBX-ZHZULCJRSA-N |
| XLogP | 3.83 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|