C24H28N4O4S2 — CID 5265050
ethyl 1-[5-cyano-1-ethyl-4-methyl-6-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 5265050) has the molecular formula C24H28N4O4S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is ethyl 1-[5-cyano-1-ethyl-4-methyl-6-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-cyano-1-ethyl-4-methyl-6-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 5265050 |
| Molecular Formula | C24H28N4O4S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | ethyl 1-[5-cyano-1-ethyl-4-methyl-6-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | C=CCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CC)c2N2CCC(C(=O)OCC)CC2)SC1=S |
| InChI | InChI=1S/C24H28N4O4S2/c1-5-10-28-22(30)19(34-24(28)33)13-17-15(4)18(14-25)21(29)27(6-2)20(17)26-11-8-16(9-12-26)23(31)32-7-3/h5,13,16H,1,6-12H2,2-4H3 |
| InChIKey | YICTVBVQWPQVGN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|