C27H34N4O6S2 — CID 23429309
6-[(5E)-5-[[5-cyano-2-(3-ethoxycarbonylpiperidin-1-yl)-1-ethyl-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 23429309) has the molecular formula C27H34N4O6S2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 6-[(5E)-5-[[5-cyano-2-(3-ethoxycarbonylpiperidin-1-yl)-1-ethyl-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5E)-5-[[5-cyano-2-(3-ethoxycarbonylpiperidin-1-yl)-1-ethyl-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 23429309 |
| Molecular Formula | C27H34N4O6S2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 6-[(5E)-5-[[5-cyano-2-(3-ethoxycarbonylpiperidin-1-yl)-1-ethyl-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCOC(=O)C1CCCN(c2c(/C=C3/SC(=S)N(CCCCCC(=O)O)C3=O)c(C)c(C#N)c(=O)n2CC)C1 |
| InChI | InChI=1S/C27H34N4O6S2/c1-4-30-23(29-12-9-10-18(16-29)26(36)37-5-2)19(17(3)20(15-28)24(30)34)14-21-25(35)31(27(38)39-21)13-8-6-7-11-22(32)33/h14,18H,4-13,16H2,1-3H3,(H,32,33)/b21-14+ |
| InChIKey | BCTNAJVNIFBLBH-KGENOOAVSA-N |
| XLogP | 3.67 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|