C26H34N4O4S2 — CID 5266795
ethyl 1-[1-butyl-5-cyano-4-methyl-6-oxo-3-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-3-carboxylate (PubChem CID 5266795) has the molecular formula C26H34N4O4S2 and a molecular weight of 530.72 g/mol. Its IUPAC name is ethyl 1-[1-butyl-5-cyano-4-methyl-6-oxo-3-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-butyl-5-cyano-4-methyl-6-oxo-3-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 5266795 |
| Molecular Formula | C26H34N4O4S2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | ethyl 1-[1-butyl-5-cyano-4-methyl-6-oxo-3-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperidine-3-carboxylate |
| SMILES | CCCCn1c(N2CCCC(C(=O)OCC)C2)c(C=C2SC(=S)N(CCC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H34N4O4S2/c1-5-8-13-29-22(28-12-9-10-18(16-28)25(33)34-7-3)19(17(4)20(15-27)23(29)31)14-21-24(32)30(11-6-2)26(35)36-21/h14,18H,5-13,16H2,1-4H3 |
| InChIKey | SVEMDUGUQAALHP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|