C31H44N4O4S2 — CID 6317833
ethyl 1-[1-butyl-5-cyano-4-methyl-3-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-oxo-2-pyridinyl]piperidine-3-carboxylate (PubChem CID 6317833) has the molecular formula C31H44N4O4S2 and a molecular weight of 600.85 g/mol. Its IUPAC name is ethyl 1-[1-butyl-5-cyano-4-methyl-3-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-oxo-2-pyridinyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-butyl-5-cyano-4-methyl-3-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-oxo-2-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 6317833 |
| Molecular Formula | C31H44N4O4S2 |
| Molecular Weight | 600.85 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | ethyl 1-[1-butyl-5-cyano-4-methyl-3-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-oxo-2-pyridinyl]piperidine-3-carboxylate |
| SMILES | CCCCCCCCN1C(=O)/C(=C/c2c(C)c(C#N)c(=O)n(CCCC)c2N2CCCC(C(=O)OCC)C2)SC1=S |
| InChI | InChI=1S/C31H44N4O4S2/c1-5-8-10-11-12-13-18-35-29(37)26(41-31(35)40)19-24-22(4)25(20-32)28(36)34(17-9-6-2)27(24)33-16-14-15-23(21-33)30(38)39-7-3/h19,23H,5-18,21H2,1-4H3/b26-19- |
| InChIKey | PBZUGEMJVMBQTB-XHPQRKPJSA-N |
| XLogP | 6.17 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.85 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|