C29H40N4O4S2 — CID 23430596
ethyl 1-[1-butyl-5-cyano-3-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 23430596) has the molecular formula C29H40N4O4S2 and a molecular weight of 572.80 g/mol. Its IUPAC name is ethyl 1-[1-butyl-5-cyano-3-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-butyl-5-cyano-3-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23430596 |
| Molecular Formula | C29H40N4O4S2 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | ethyl 1-[1-butyl-5-cyano-3-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-oxo-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CCCC)c2N2CCC(C(=O)OCC)CC2)SC1=S |
| InChI | InChI=1S/C29H40N4O4S2/c1-5-8-10-11-15-33-27(35)24(39-29(33)38)18-22-20(4)23(19-30)26(34)32(14-9-6-2)25(22)31-16-12-21(13-17-31)28(36)37-7-3/h18,21H,5-17H2,1-4H3/b24-18+ |
| InChIKey | CLNYFACTSZWSAR-HKOYGPOVSA-N |
| XLogP | 5.39 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|