C17H24N3O2S+ — CID 9169683
ethyl (3R)-1-[(3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 9169683) has the molecular formula C17H24N3O2S+ and a molecular weight of 334.47 g/mol. Its IUPAC name is ethyl (3R)-1-[(3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 9169683 |
| Molecular Formula | C17H24N3O2S+ |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl (3R)-1-[(3-cyano-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](Cn2c(C)cc(C)c(C#N)c2=S)C1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-22-17(21)14-6-5-7-19(10-14)11-20-13(3)8-12(2)15(9-18)16(20)23/h8,14H,4-7,10-11H2,1-3H3/p+1/t14-/m1/s1 |
| InChIKey | ZEIRXPUWYICRLT-CQSZACIVSA-O |
| XLogP | 1.52 |
| TPSA | 59.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|