C12H21N4O2S+ — CID 2374778
ethyl (3S)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 2374778) has the molecular formula C12H21N4O2S+ and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl (3S)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 2374778 |
| Molecular Formula | C12H21N4O2S+ |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | ethyl (3S)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](Cn2ncn(C)c2=S)C1 |
| InChI | InChI=1S/C12H20N4O2S/c1-3-18-11(17)10-5-4-6-15(7-10)9-16-12(19)14(2)8-13-16/h8,10H,3-7,9H2,1-2H3/p+1/t10-/m0/s1 |
| InChIKey | AHJNGYOBSUEKAE-JTQLQIEISA-O |
| XLogP | -0.23 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|