C18H25N5O2S — CID 9245476
ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidine-4-carboxylate (PubChem CID 9245476) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9245476 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl 1-[[4-(2,3-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2nnn(-c3cccc(C)c3C)c2=S)CC1 |
| InChI | InChI=1S/C18H25N5O2S/c1-4-25-17(24)15-8-10-21(11-9-15)12-22-18(26)23(20-19-22)16-7-5-6-13(2)14(16)3/h5-7,15H,4,8-12H2,1-3H3 |
| InChIKey | GWTGRHVTXIVZMI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|