C15H19F2NO2 — CID 115879637
ethyl 1-[(2,6-difluorophenyl)methyl]piperidine-4-carboxylate (PubChem CID 115879637) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is ethyl 1-[(2,6-difluorophenyl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2,6-difluorophenyl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 115879637 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl 1-[(2,6-difluorophenyl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C15H19F2NO2/c1-2-20-15(19)11-6-8-18(9-7-11)10-12-13(16)4-3-5-14(12)17/h3-5,11H,2,6-10H2,1H3 |
| InChIKey | ZJKDOMURTFCWKR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |