C20H25N6S+ — CID 9241938
1-(2,3-dimethylphenyl)-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione (PubChem CID 9241938) has the molecular formula C20H25N6S+ and a molecular weight of 381.53 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione.
| Compound Name | 1-(2,3-dimethylphenyl)-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9241938 |
| Molecular Formula | C20H25N6S+ |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-[(4-phenylpiperazin-1-ium-1-yl)methyl]tetrazole-5-thione |
| SMILES | Cc1cccc(-n2nnn(C[NH+]3CCN(c4ccccc4)CC3)c2=S)c1C |
| InChI | InChI=1S/C20H24N6S/c1-16-7-6-10-19(17(16)2)26-20(27)25(21-22-26)15-23-11-13-24(14-12-23)18-8-4-3-5-9-18/h3-10H,11-15H2,1-2H3/p+1 |
| InChIKey | QUYVLZFGVARBTQ-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|