C22H27N6OS+ — CID 9243905
1-[4-[4-[[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone (PubChem CID 9243905) has the molecular formula C22H27N6OS+ and a molecular weight of 423.57 g/mol. Its IUPAC name is 1-[4-[4-[[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 9243905 |
| Molecular Formula | C22H27N6OS+ |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[4-[4-[[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CC[NH+](Cn3nnn(-c4cc(C)cc(C)c4)c3=S)CC2)cc1 |
| InChI | InChI=1S/C22H26N6OS/c1-16-12-17(2)14-21(13-16)28-22(30)27(23-24-28)15-25-8-10-26(11-9-25)20-6-4-19(5-7-20)18(3)29/h4-7,12-14H,8-11,15H2,1-3H3/p+1 |
| InChIKey | HTJBZMMXAIPTTL-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|