C22H31N2O+ — CID 7440853
1-[4-[4-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone (PubChem CID 7440853) has the molecular formula C22H31N2O+ and a molecular weight of 339.50 g/mol. Its IUPAC name is 1-[4-[4-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 7440853 |
| Molecular Formula | C22H31N2O+ |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 1-[4-[4-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]piperazin-4-ium-1-yl]phenyl]ethanone |
| SMILES | C=C(C)[C@H]1CC=C(C[NH+]2CCN(c3ccc(C(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H30N2O/c1-17(2)20-6-4-19(5-7-20)16-23-12-14-24(15-13-23)22-10-8-21(9-11-22)18(3)25/h4,8-11,20H,1,5-7,12-16H2,2-3H3/p+1/t20-/m0/s1 |
| InChIKey | RTQLAEOHRBJJQB-FQEVSTJZSA-O |
| XLogP | 2.90 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|