C23H24BrN2O2+ — CID 2470381
1-[4-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]phenyl]ethanone (PubChem CID 2470381) has the molecular formula C23H24BrN2O2+ and a molecular weight of 440.36 g/mol. Its IUPAC name is 1-[4-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 2470381 |
| Molecular Formula | C23H24BrN2O2+ |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 1-[4-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CC[NH+](Cc3c(O)ccc4cc(Br)ccc34)CC2)cc1 |
| InChI | InChI=1S/C23H23BrN2O2/c1-16(27)17-2-6-20(7-3-17)26-12-10-25(11-13-26)15-22-21-8-5-19(24)14-18(21)4-9-23(22)28/h2-9,14,28H,10-13,15H2,1H3/p+1 |
| InChIKey | GQIBUTSJCGMINX-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|