C17H20BrN2O2+ — CID 7999606
1-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]ethanone (PubChem CID 7999606) has the molecular formula C17H20BrN2O2+ and a molecular weight of 364.26 g/mol. Its IUPAC name is 1-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]ethanone.
| Compound Name | 1-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 7999606 |
| Molecular Formula | C17H20BrN2O2+ |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 1-[4-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperazin-4-ium-1-yl]ethanone |
| SMILES | CC(=O)N1CC[NH+](Cc2c(O)ccc3cc(Br)ccc23)CC1 |
| InChI | InChI=1S/C17H19BrN2O2/c1-12(21)20-8-6-19(7-9-20)11-16-15-4-3-14(18)10-13(15)2-5-17(16)22/h2-5,10,22H,6-9,11H2,1H3/p+1 |
| InChIKey | HCFBANBNACXBKJ-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|