C15H17BrNO2+ — CID 2480255
6-bromo-1-(morpholin-4-ium-4-ylmethyl)naphthalen-2-ol (PubChem CID 2480255) has the molecular formula C15H17BrNO2+ and a molecular weight of 323.21 g/mol. Its IUPAC name is 6-bromo-1-(morpholin-4-ium-4-ylmethyl)naphthalen-2-ol.
| Compound Name | 6-bromo-1-(morpholin-4-ium-4-ylmethyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 2480255 |
| Molecular Formula | C15H17BrNO2+ |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 6-bromo-1-(morpholin-4-ium-4-ylmethyl)naphthalen-2-ol |
| SMILES | Oc1ccc2cc(Br)ccc2c1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H16BrNO2/c16-12-2-3-13-11(9-12)1-4-15(18)14(13)10-17-5-7-19-8-6-17/h1-4,9,18H,5-8,10H2/p+1 |
| InChIKey | NNWSWCYZKPSEBI-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|