C19H23BrNO3+ — CID 2453069
ethyl (3S)-1-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 2453069) has the molecular formula C19H23BrNO3+ and a molecular weight of 393.30 g/mol. Its IUPAC name is ethyl (3S)-1-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 2453069 |
| Molecular Formula | C19H23BrNO3+ |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | ethyl (3S)-1-[(6-bromo-2-hydroxynaphthalen-1-yl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](Cc2c(O)ccc3cc(Br)ccc23)C1 |
| InChI | InChI=1S/C19H22BrNO3/c1-2-24-19(23)14-4-3-9-21(11-14)12-17-16-7-6-15(20)10-13(16)5-8-18(17)22/h5-8,10,14,22H,2-4,9,11-12H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | JJBBFGQVUKCGPB-AWEZNQCLSA-O |
| XLogP | 2.67 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|