C20H19BrNO4+ — CID 2028356
(2Z)-2-[(3-bromophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one (PubChem CID 2028356) has the molecular formula C20H19BrNO4+ and a molecular weight of 417.28 g/mol. Its IUPAC name is (2Z)-2-[(3-bromophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3-bromophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2028356 |
| Molecular Formula | C20H19BrNO4+ |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | (2Z)-2-[(3-bromophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2cccc(Br)c2)Oc2c1ccc(O)c2C[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H18BrNO4/c21-14-3-1-2-13(10-14)11-18-19(24)15-4-5-17(23)16(20(15)26-18)12-22-6-8-25-9-7-22/h1-5,10-11,23H,6-9,12H2/p+1/b18-11- |
| InChIKey | IHAFDMKKRKZHEI-WQRHYEAKSA-O |
| XLogP | 2.19 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|