C20H19FNO4+ — CID 7197940
(2Z)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one (PubChem CID 7197940) has the molecular formula C20H19FNO4+ and a molecular weight of 356.37 g/mol. Its IUPAC name is (2Z)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 7197940 |
| Molecular Formula | C20H19FNO4+ |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2Z)-2-[(2-fluorophenyl)methylidene]-6-hydroxy-7-(morpholin-4-ium-4-ylmethyl)-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccccc2F)Oc2c1ccc(O)c2C[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H18FNO4/c21-16-4-2-1-3-13(16)11-18-19(24)14-5-6-17(23)15(20(14)26-18)12-22-7-9-25-10-8-22/h1-6,11,23H,7-10,12H2/p+1/b18-11- |
| InChIKey | CLEDBYBGMDKNGH-WQRHYEAKSA-O |
| XLogP | 1.56 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|