C19H22N2O3S+2 — CID 2038661
(2E)-6-hydroxy-7-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one (PubChem CID 2038661) has the molecular formula C19H22N2O3S+2 and a molecular weight of 358.46 g/mol. Its IUPAC name is (2E)-6-hydroxy-7-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | (2E)-6-hydroxy-7-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2038661 |
| Molecular Formula | C19H22N2O3S+2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2E)-6-hydroxy-7-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-2-(thiophen-2-ylmethylidene)-1-benzofuran-3-one |
| SMILES | C[NH+]1CC[NH+](Cc2c(O)ccc3c2O/C(=C/c2cccs2)C3=O)CC1 |
| InChI | InChI=1S/C19H20N2O3S/c1-20-6-8-21(9-7-20)12-15-16(22)5-4-14-18(23)17(24-19(14)15)11-13-3-2-10-25-13/h2-5,10-11,22H,6-9,12H2,1H3/p+2/b17-11+ |
| InChIKey | QZTQFTBLNVUJEF-GZTJUZNOSA-P |
| XLogP | -0.02 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|