C11H16BrN2OS+ — CID 6935482
1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-4-ium-1-yl]ethanone (PubChem CID 6935482) has the molecular formula C11H16BrN2OS+ and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-4-ium-1-yl]ethanone.
| Compound Name | 1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 6935482 |
| Molecular Formula | C11H16BrN2OS+ |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-[4-[(5-bromothiophen-2-yl)methyl]piperazin-4-ium-1-yl]ethanone |
| SMILES | CC(=O)N1CC[NH+](Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C11H15BrN2OS/c1-9(15)14-6-4-13(5-7-14)8-10-2-3-11(12)16-10/h2-3H,4-8H2,1H3/p+1 |
| InChIKey | DJIREERJIYHRHW-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |