C13H18ClN2O+ — CID 6943021
1-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]ethanone (PubChem CID 6943021) has the molecular formula C13H18ClN2O+ and a molecular weight of 253.75 g/mol. Its IUPAC name is 1-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]ethanone.
| Compound Name | 1-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 6943021 |
| Molecular Formula | C13H18ClN2O+ |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]ethanone |
| SMILES | CC(=O)N1CC[NH+](Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C13H17ClN2O/c1-11(17)16-8-6-15(7-9-16)10-12-4-2-3-5-13(12)14/h2-5H,6-10H2,1H3/p+1 |
| InChIKey | XABXNFMIUNTQQU-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |