C17H26ClN2O+ — CID 7334869
1-[(2-chlorophenyl)methyl]-N-(2-methylpropyl)piperidin-1-ium-4-carboxamide (PubChem CID 7334869) has the molecular formula C17H26ClN2O+ and a molecular weight of 309.86 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-(2-methylpropyl)piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-(2-methylpropyl)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7334869 |
| Molecular Formula | C17H26ClN2O+ |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-(2-methylpropyl)piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)CNC(=O)C1CC[NH+](Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN2O/c1-13(2)11-19-17(21)14-7-9-20(10-8-14)12-15-5-3-4-6-16(15)18/h3-6,13-14H,7-12H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | KQTWWLASBMRJQK-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |