C21H26ClN2O+ — CID 7334954
1-[(2-chlorophenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7334954) has the molecular formula C21H26ClN2O+ and a molecular weight of 357.90 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7334954 |
| Molecular Formula | C21H26ClN2O+ |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CC[NH+](Cc2ccccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O/c1-16(17-7-3-2-4-8-17)23-21(25)18-11-13-24(14-12-18)15-19-9-5-6-10-20(19)22/h2-10,16,18H,11-15H2,1H3,(H,23,25)/p+1/t16-/m1/s1 |
| InChIKey | INRBYXBJVMBFPK-MRXNPFEDSA-O |
| XLogP | 3.01 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |