C24H33N2O3+ — CID 7324355
1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7324355) has the molecular formula C24H33N2O3+ and a molecular weight of 397.54 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7324355 |
| Molecular Formula | C24H33N2O3+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxyphenyl)methyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide |
| SMILES | CCOc1ccc(C[NH+]2CCC(C(=O)N[C@H](C)c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C24H32N2O3/c1-4-29-22-11-10-19(16-23(22)28-3)17-26-14-12-21(13-15-26)24(27)25-18(2)20-8-6-5-7-9-20/h5-11,16,18,21H,4,12-15,17H2,1-3H3,(H,25,27)/p+1/t18-/m1/s1 |
| InChIKey | QDOHAPSPBNXXPF-GOSISDBHSA-O |
| XLogP | 2.77 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |