C22H29N2O3+ — CID 7324125
N-benzyl-1-[(3-ethoxy-4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 7324125) has the molecular formula C22H29N2O3+ and a molecular weight of 369.49 g/mol. Its IUPAC name is N-benzyl-1-[(3-ethoxy-4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-benzyl-1-[(3-ethoxy-4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7324125 |
| Molecular Formula | C22H29N2O3+ |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-benzyl-1-[(3-ethoxy-4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | CCOc1cc(C[NH+]2CCC(C(=O)NCc3ccccc3)CC2)ccc1O |
| InChI | InChI=1S/C22H28N2O3/c1-2-27-21-14-18(8-9-20(21)25)16-24-12-10-19(11-13-24)22(26)23-15-17-6-4-3-5-7-17/h3-9,14,19,25H,2,10-13,15-16H2,1H3,(H,23,26)/p+1 |
| InChIKey | MCSKUEYMGCSRFI-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |