C23H31N2O2+ — CID 6964251
1-[(2-ethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 6964251) has the molecular formula C23H31N2O2+ and a molecular weight of 367.51 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2-ethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6964251 |
| Molecular Formula | C23H31N2O2+ |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-[(2-ethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | CCOc1ccccc1C[NH+]1CCC(C(=O)NCc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-3-27-22-7-5-4-6-21(22)17-25-14-12-20(13-15-25)23(26)24-16-19-10-8-18(2)9-11-19/h4-11,20H,3,12-17H2,1-2H3,(H,24,26)/p+1 |
| InChIKey | DMIPUQUSJHSCEN-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |