C24H31N2O+ — CID 7334957
1-[(E)-2-methyl-3-phenylprop-2-enyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7334957) has the molecular formula C24H31N2O+ and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-[(E)-2-methyl-3-phenylprop-2-enyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(E)-2-methyl-3-phenylprop-2-enyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7334957 |
| Molecular Formula | C24H31N2O+ |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[(E)-2-methyl-3-phenylprop-2-enyl]-N-[(1R)-1-phenylethyl]piperidin-1-ium-4-carboxamide |
| SMILES | C/C(=C\c1ccccc1)C[NH+]1CCC(C(=O)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O/c1-19(17-21-9-5-3-6-10-21)18-26-15-13-23(14-16-26)24(27)25-20(2)22-11-7-4-8-12-22/h3-12,17,20,23H,13-16,18H2,1-2H3,(H,25,27)/p+1/b19-17+/t20-/m1/s1 |
| InChIKey | KKKWPCQEYDOALJ-LFNFIXQYSA-O |
| XLogP | 3.26 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |