C19H22ClN4O2+ — CID 6973039
(E)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)ethanimine (PubChem CID 6973039) has the molecular formula C19H22ClN4O2+ and a molecular weight of 373.86 g/mol. Its IUPAC name is (E)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)ethanimine.
| Compound Name | (E)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)ethanimine |
|---|---|
| PubChem CID | 6973039 |
| Molecular Formula | C19H22ClN4O2+ |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (E)-N-[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)ethanimine |
| SMILES | C/C(=N\N1CC[NH+](Cc2ccccc2Cl)CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-15(16-6-4-7-18(13-16)24(25)26)21-23-11-9-22(10-12-23)14-17-5-2-3-8-19(17)20/h2-8,13H,9-12,14H2,1H3/p+1/b21-15+ |
| InChIKey | XABNGEVEAXMMPW-RCCKNPSSSA-O |
| XLogP | 2.37 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|