C19H23N4O2+ — CID 2180308
N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)methanimine (PubChem CID 2180308) has the molecular formula C19H23N4O2+ and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)methanimine.
| Compound Name | N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 2180308 |
| Molecular Formula | C19H23N4O2+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]-1-(3-nitrophenyl)methanimine |
| SMILES | Cc1ccc(C[NH+]2CCN(N=Cc3cccc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-16-5-7-17(8-6-16)15-21-9-11-22(12-10-21)20-14-18-3-2-4-19(13-18)23(24)25/h2-8,13-14H,9-12,15H2,1H3/p+1 |
| InChIKey | LVTSHKAPFSMDRC-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|