C20H25ClN3+ — CID 6897565
(E)-1-(3-chlorophenyl)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]methanimine (PubChem CID 6897565) has the molecular formula C20H25ClN3+ and a molecular weight of 342.89 g/mol. Its IUPAC name is (E)-1-(3-chlorophenyl)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]methanimine.
| Compound Name | (E)-1-(3-chlorophenyl)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]methanimine |
|---|---|
| PubChem CID | 6897565 |
| Molecular Formula | C20H25ClN3+ |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (E)-1-(3-chlorophenyl)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]methanimine |
| SMILES | Cc1ccc(C[NH+]2CCN(/N=C/c3cccc(Cl)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H24ClN3/c1-16-6-7-19(17(2)12-16)15-23-8-10-24(11-9-23)22-14-18-4-3-5-20(21)13-18/h3-7,12-14H,8-11,15H2,1-2H3/p+1/b22-14+ |
| InChIKey | JJWHTBQHMIFFKB-HYARGMPZSA-O |
| XLogP | 2.69 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|