C22H30N3O2+ — CID 2144594
4-[[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-ethoxyphenol (PubChem CID 2144594) has the molecular formula C22H30N3O2+ and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-[[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-ethoxyphenol.
| Compound Name | 4-[[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 2144594 |
| Molecular Formula | C22H30N3O2+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-[[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]iminomethyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(C=NN2CC[NH+](Cc3ccc(C)cc3C)CC2)ccc1O |
| InChI | InChI=1S/C22H29N3O2/c1-4-27-22-14-19(6-8-21(22)26)15-23-25-11-9-24(10-12-25)16-20-7-5-17(2)13-18(20)3/h5-8,13-15,26H,4,9-12,16H2,1-3H3/p+1 |
| InChIKey | AIRSOJITXLPOPG-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|