C17H19NO2 — CID 135722054
4-[(3,5-dimethylphenyl)iminomethyl]-2-ethoxyphenol (PubChem CID 135722054) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)iminomethyl]-2-ethoxyphenol.
| Compound Name | 4-[(3,5-dimethylphenyl)iminomethyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 135722054 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)iminomethyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(/C=N/c2cc(C)cc(C)c2)ccc1O |
| InChI | InChI=1S/C17H19NO2/c1-4-20-17-10-14(5-6-16(17)19)11-18-15-8-12(2)7-13(3)9-15/h5-11,19H,4H2,1-3H3/b18-11+ |
| InChIKey | PDBGJEVAWJNAFH-WOJGMQOQSA-N |
| XLogP | 4.16 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|