C19H26N3S+ — CID 6893930
(E)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]-1-(5-methylthiophen-2-yl)methanimine (PubChem CID 6893930) has the molecular formula C19H26N3S+ and a molecular weight of 328.51 g/mol. Its IUPAC name is (E)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]-1-(5-methylthiophen-2-yl)methanimine.
| Compound Name | (E)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]-1-(5-methylthiophen-2-yl)methanimine |
|---|---|
| PubChem CID | 6893930 |
| Molecular Formula | C19H26N3S+ |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (E)-N-[4-[(2,4-dimethylphenyl)methyl]piperazin-4-ium-1-yl]-1-(5-methylthiophen-2-yl)methanimine |
| SMILES | Cc1ccc(C[NH+]2CCN(/N=C/c3ccc(C)s3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H25N3S/c1-15-4-6-18(16(2)12-15)14-21-8-10-22(11-9-21)20-13-19-7-5-17(3)23-19/h4-7,12-13H,8-11,14H2,1-3H3/p+1/b20-13+ |
| InChIKey | RWJWQVGTKBUHNR-DEDYPNTBSA-O |
| XLogP | 2.41 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|